C10H13ClO — CID 143514508
(3E,5E)-3-[(Z)-but-2-en-2-yl]-6-chlorohexa-3,5-dien-2-one (PubChem CID 143514508) has the molecular formula C10H13ClO and a molecular weight of 184.67 g/mol. Its IUPAC name is (3E,5E)-3-[(Z)-but-2-en-2-yl]-6-chlorohexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-3-[(Z)-but-2-en-2-yl]-6-chlorohexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 143514508 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3E,5E)-3-[(Z)-but-2-en-2-yl]-6-chlorohexa-3,5-dien-2-one |
| SMILES | C/C=C(C)\C(=C/C=C/Cl)C(C)=O |
| InChI | InChI=1S/C10H13ClO/c1-4-8(2)10(9(3)12)6-5-7-11/h4-7H,1-3H3/b7-5+,8-4-,10-6+ |
| InChIKey | LUQXKXBXQLEXMP-CNIAEBDBSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|