C14H24FNO — CID 142910031
(3E,5Z)-N,3-diethyl-N-methylocta-3,5,7-trienamide;fluoromethane (PubChem CID 142910031) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is (3E,5Z)-N,3-diethyl-N-methylocta-3,5,7-trienamide;fluoromethane.
| Compound Name | (3E,5Z)-N,3-diethyl-N-methylocta-3,5,7-trienamide;fluoromethane |
|---|---|
| PubChem CID | 142910031 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (3E,5Z)-N,3-diethyl-N-methylocta-3,5,7-trienamide;fluoromethane |
| SMILES | C=C/C=C\C=C(/CC)CC(=O)N(C)CC.CF |
| InChI | InChI=1S/C13H21NO.CH3F/c1-5-8-9-10-12(6-2)11-13(15)14(4)7-3;1-2/h5,8-10H,1,6-7,11H2,2-4H3;1H3/b9-8-,12-10+; |
| InChIKey | OJKYJXIGYPEGKC-ZTEDHSSBSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|