C10H16N2 — CID 166999090
(2Z)-N'-ethenyl-N-ethyl-N-methylpenta-2,4-dienimidamide (PubChem CID 166999090) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2Z)-N'-ethenyl-N-ethyl-N-methylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-N'-ethenyl-N-ethyl-N-methylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 166999090 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2Z)-N'-ethenyl-N-ethyl-N-methylpenta-2,4-dienimidamide |
| SMILES | C=C/C=C\C(=N\C=C)N(C)CC |
| InChI | InChI=1S/C10H16N2/c1-5-8-9-10(11-6-2)12(4)7-3/h5-6,8-9H,1-2,7H2,3-4H3/b9-8-,11-10- |
| InChIKey | KBQHDVRTSOJCDB-XESWYYRISA-N |
| XLogP | 2.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|