C15H23N — CID 143996029
ethane;(2Z,5E,6Z)-N-ethenyl-5-ethylidenenona-2,6,8-trien-4-imine (PubChem CID 143996029) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is ethane;(2Z,5E,6Z)-N-ethenyl-5-ethylidenenona-2,6,8-trien-4-imine.
| Compound Name | ethane;(2Z,5E,6Z)-N-ethenyl-5-ethylidenenona-2,6,8-trien-4-imine |
|---|---|
| PubChem CID | 143996029 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | ethane;(2Z,5E,6Z)-N-ethenyl-5-ethylidenenona-2,6,8-trien-4-imine |
| SMILES | C=C/C=C\C(=C/C)C(/C=C\C)=N\C=C.CC |
| InChI | InChI=1S/C13H17N.C2H6/c1-5-9-11-12(7-3)13(10-6-2)14-8-4;1-2/h5-11H,1,4H2,2-3H3;1-2H3/b10-6-,11-9-,12-7+,14-13+; |
| InChIKey | TVIIPEICHHDPSP-CFHXQHFESA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|