C14H19N — CID 143256701
(3Z,5Z)-N-[(Z)-but-2-en-2-yl]-3-ethylideneocta-1,5,7-trien-4-imine (PubChem CID 143256701) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (3Z,5Z)-N-[(Z)-but-2-en-2-yl]-3-ethylideneocta-1,5,7-trien-4-imine.
| Compound Name | (3Z,5Z)-N-[(Z)-but-2-en-2-yl]-3-ethylideneocta-1,5,7-trien-4-imine |
|---|---|
| PubChem CID | 143256701 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (3Z,5Z)-N-[(Z)-but-2-en-2-yl]-3-ethylideneocta-1,5,7-trien-4-imine |
| SMILES | C=C/C=C\C(=N\C(C)=C/C)\C(C=C)=C/C |
| InChI | InChI=1S/C14H19N/c1-6-10-11-14(13(8-3)9-4)15-12(5)7-2/h6-11H,1,3H2,2,4-5H3/b11-10-,12-7-,13-9-,15-14- |
| InChIKey | WLFLVDRELQNPFX-LYADBNLDSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|