C11H15F3O — CID 167454671
ethane;(3E,4Z)-3-ethylidene-1,1,1-trifluorohepta-4,6-dien-2-one (PubChem CID 167454671) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is ethane;(3E,4Z)-3-ethylidene-1,1,1-trifluorohepta-4,6-dien-2-one.
| Compound Name | ethane;(3E,4Z)-3-ethylidene-1,1,1-trifluorohepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 167454671 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethane;(3E,4Z)-3-ethylidene-1,1,1-trifluorohepta-4,6-dien-2-one |
| SMILES | C=C/C=C\C(=C/C)C(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C9H9F3O.C2H6/c1-3-5-6-7(4-2)8(13)9(10,11)12;1-2/h3-6H,1H2,2H3;1-2H3/b6-5-,7-4+; |
| InChIKey | KJHWKHPHOPBIGX-BIFKCLKRSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|