C12H22F3NO2S — CID 143371256
ethane;1,1,1-trifluoro-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]methanesulfonamide (PubChem CID 143371256) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]methanesulfonamide.
| Compound Name | ethane;1,1,1-trifluoro-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 143371256 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethane;1,1,1-trifluoro-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]methanesulfonamide |
| SMILES | C=C/C=C\C(=C/C)NS(=O)(=O)C(F)(F)F.CC.CC |
| InChI | InChI=1S/C8H10F3NO2S.2C2H6/c1-3-5-6-7(4-2)12-15(13,14)8(9,10)11;2*1-2/h3-6,12H,1H2,2H3;2*1-2H3/b6-5-,7-4+;; |
| InChIKey | BMEOAHJSZCVIFS-DORRUZTLSA-N |
| XLogP | 4.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|