C9H17NO2S — CID 143436219
ethane;N-[(3Z)-hexa-1,3,5-trien-2-yl]methanesulfonamide (PubChem CID 143436219) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is ethane;N-[(3Z)-hexa-1,3,5-trien-2-yl]methanesulfonamide.
| Compound Name | ethane;N-[(3Z)-hexa-1,3,5-trien-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 143436219 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | ethane;N-[(3Z)-hexa-1,3,5-trien-2-yl]methanesulfonamide |
| SMILES | C=C/C=C\C(=C)NS(C)(=O)=O.CC |
| InChI | InChI=1S/C7H11NO2S.C2H6/c1-4-5-6-7(2)8-11(3,9)10;1-2/h4-6,8H,1-2H2,3H3;1-2H3/b6-5-; |
| InChIKey | QGIDKDSBFVNHIA-YSMBQZINSA-N |
| XLogP | 1.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|