C15H16N2O4S — CID 155183718
4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylbenzene-1,4-dicarboxamide (PubChem CID 155183718) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 155183718 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylbenzene-1,4-dicarboxamide |
| SMILES | C=C/C=C\C(=C/C)S(=O)(=O)NC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C15H16N2O4S/c1-3-5-6-13(4-2)22(20,21)17-15(19)12-9-7-11(8-10-12)14(16)18/h3-10H,1H2,2H3,(H2,16,18)(H,17,19)/b6-5-,13-4+ |
| InChIKey | SUBAEOFNMKQFQZ-BDNXDWBHSA-N |
| XLogP | 1.49 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|