C15H18N2O3S — CID 137404039
4-[[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylamino]benzamide (PubChem CID 137404039) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylamino]benzamide.
| Compound Name | 4-[[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 137404039 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylamino]benzamide |
| SMILES | C/C=C\C=C(/C=C\C)S(=O)(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-3-5-7-14(6-4-2)21(19,20)17-13-10-8-12(9-11-13)15(16)18/h3-11,17H,1-2H3,(H2,16,18)/b5-3-,6-4-,14-7+ |
| InChIKey | IIUJDNLFRBYKQQ-XAFXJDKQSA-N |
| XLogP | 2.56 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|