C13H10F2N2O3S — CID 4880807
4-[(2,6-difluorophenyl)sulfonylamino]benzamide (PubChem CID 4880807) has the molecular formula C13H10F2N2O3S and a molecular weight of 312.30 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)sulfonylamino]benzamide.
| Compound Name | 4-[(2,6-difluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 4880807 |
| Molecular Formula | C13H10F2N2O3S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-[(2,6-difluorophenyl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1ccc(NS(=O)(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C13H10F2N2O3S/c14-10-2-1-3-11(15)12(10)21(19,20)17-9-6-4-8(5-7-9)13(16)18/h1-7,17H,(H2,16,18) |
| InChIKey | WBASXFZOLUWKCF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |