C14H10F3NO4S — CID 33490699
methyl 5-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoate (PubChem CID 33490699) has the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. Its IUPAC name is methyl 5-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoate.
| Compound Name | methyl 5-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 33490699 |
| Molecular Formula | C14H10F3NO4S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | methyl 5-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2c(F)cccc2F)ccc1F |
| InChI | InChI=1S/C14H10F3NO4S/c1-22-14(19)9-7-8(5-6-10(9)15)18-23(20,21)13-11(16)3-2-4-12(13)17/h2-7,18H,1H3 |
| InChIKey | IHCACCJKOKLBCR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |