C11H10FN3O4S — CID 102691734
methyl 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzoate (PubChem CID 102691734) has the molecular formula C11H10FN3O4S and a molecular weight of 299.28 g/mol. Its IUPAC name is methyl 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzoate.
| Compound Name | methyl 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 102691734 |
| Molecular Formula | C11H10FN3O4S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | methyl 2-fluoro-5-(1H-pyrazol-5-ylsulfonylamino)benzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccn[nH]2)ccc1F |
| InChI | InChI=1S/C11H10FN3O4S/c1-19-11(16)8-6-7(2-3-9(8)12)15-20(17,18)10-4-5-13-14-10/h2-6,15H,1H3,(H,13,14) |
| InChIKey | XZKFSZSDHAEYMF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |