C20H27N3O4 — CID 155734100
N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-4-methoxybenzamide;(3Z,5Z)-5-methylhepta-1,3,5-triene (PubChem CID 155734100) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-4-methoxybenzamide;(3Z,5Z)-5-methylhepta-1,3,5-triene.
| Compound Name | N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-4-methoxybenzamide;(3Z,5Z)-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 155734100 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-4-methoxybenzamide;(3Z,5Z)-5-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(C)=C/C.COc1ccc(C(=O)NCC(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C12H15N3O4.C8H12/c1-19-9-4-2-8(3-5-9)12(18)15-7-11(17)14-6-10(13)16;1-4-6-7-8(3)5-2/h2-5H,6-7H2,1H3,(H2,13,16)(H,14,17)(H,15,18);4-7H,1H2,2-3H3/b;7-6-,8-5- |
| InChIKey | UIFDURILOXLLQH-JLMZEHOHSA-N |
| XLogP | 1.72 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|