C11H23NO — CID 143678790
(2Z)-N,N-dimethylpenta-2,4-dienamide;ethane (PubChem CID 143678790) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (2Z)-N,N-dimethylpenta-2,4-dienamide;ethane.
| Compound Name | (2Z)-N,N-dimethylpenta-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 143678790 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2Z)-N,N-dimethylpenta-2,4-dienamide;ethane |
| SMILES | C=C/C=C\C(=O)N(C)C.CC.CC |
| InChI | InChI=1S/C7H11NO.2C2H6/c1-4-5-6-7(9)8(2)3;2*1-2/h4-6H,1H2,2-3H3;2*1-2H3/b6-5-;; |
| InChIKey | NEZNHDDWBUQHSC-XNOMRPDFSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|