C13H21NO — CID 88859213
(2E,4E)-5-tert-butyl-N,N-dimethylhepta-2,4,6-trienamide (PubChem CID 88859213) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2E,4E)-5-tert-butyl-N,N-dimethylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-5-tert-butyl-N,N-dimethylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 88859213 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2E,4E)-5-tert-butyl-N,N-dimethylhepta-2,4,6-trienamide |
| SMILES | C=C/C(=C\C=C\C(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H21NO/c1-7-11(13(2,3)4)9-8-10-12(15)14(5)6/h7-10H,1H2,2-6H3/b10-8+,11-9+ |
| InChIKey | KLVCHAFVOXUNHJ-GFULKKFKSA-N |
| XLogP | 2.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|