C18H32 — CID 91150058
3,6-ditert-butyl-7,7-dimethylocta-1,3,5-triene (PubChem CID 91150058) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 3,6-ditert-butyl-7,7-dimethylocta-1,3,5-triene.
| Compound Name | 3,6-ditert-butyl-7,7-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 91150058 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 3,6-ditert-butyl-7,7-dimethylocta-1,3,5-triene |
| SMILES | C=CC(=CC=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32/c1-11-14(16(2,3)4)12-13-15(17(5,6)7)18(8,9)10/h11-13H,1H2,2-10H3 |
| InChIKey | IWLCXXDCJCFMAL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|