C8H10F4 — CID 162612401
(3E)-5-fluoro-5-methyl-3-(trifluoromethyl)hexa-1,3-diene (PubChem CID 162612401) has the molecular formula C8H10F4 and a molecular weight of 182.16 g/mol. Its IUPAC name is (3E)-5-fluoro-5-methyl-3-(trifluoromethyl)hexa-1,3-diene.
| Compound Name | (3E)-5-fluoro-5-methyl-3-(trifluoromethyl)hexa-1,3-diene |
|---|---|
| PubChem CID | 162612401 |
| Molecular Formula | C8H10F4 |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (3E)-5-fluoro-5-methyl-3-(trifluoromethyl)hexa-1,3-diene |
| SMILES | C=C/C(=C\C(C)(C)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F4/c1-4-6(8(10,11)12)5-7(2,3)9/h4-5H,1H2,2-3H3/b6-5+ |
| InChIKey | KDWGSMKATAZLQC-AATRIKPKSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|