C8H8F3I — CID 162565488
(3E,5E)-6-iodo-3-(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 162565488) has the molecular formula C8H8F3I and a molecular weight of 288.05 g/mol. Its IUPAC name is (3E,5E)-6-iodo-3-(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (3E,5E)-6-iodo-3-(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 162565488 |
| Molecular Formula | C8H8F3I |
| Molecular Weight | 288.05 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (3E,5E)-6-iodo-3-(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C)I)C(F)(F)F |
| InChI | InChI=1S/C8H8F3I/c1-3-7(8(9,10)11)5-4-6(2)12/h3-5H,1H2,2H3/b6-4+,7-5+ |
| InChIKey | JAGOQWWQKPFZRG-YDFGWWAZSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.05 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|