C14H23F3N2 — CID 143734563
ethane;1-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine (PubChem CID 143734563) has the molecular formula C14H23F3N2 and a molecular weight of 276.35 g/mol. Its IUPAC name is ethane;1-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine.
| Compound Name | ethane;1-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 143734563 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethane;1-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine |
| SMILES | C=C/C(=C\C=C(/C)N1CCNCC1)C(F)(F)F.CC |
| InChI | InChI=1S/C12H17F3N2.C2H6/c1-3-11(12(13,14)15)5-4-10(2)17-8-6-16-7-9-17;1-2/h3-5,16H,1,6-9H2,2H3;1-2H3/b10-4+,11-5+; |
| InChIKey | UATNHCHVLRFTMD-DVHWKNMOSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|