C8H15F3N2O2 — CID 156843506
ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone (PubChem CID 156843506) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone.
| Compound Name | ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 156843506 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone |
| SMILES | CCO.O=C(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O.C2H6O/c7-6(8,9)5(12)11-3-1-10-2-4-11;1-2-3/h10H,1-4H2;3H,2H2,1H3 |
| InChIKey | PZDHSHOJDPYAPV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |