C9H16N2O3 — CID 82820893
2,2-dimethyl-3-oxo-3-piperazin-1-ylpropanoic acid (PubChem CID 82820893) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-piperazin-1-ylpropanoic acid.
| Compound Name | 2,2-dimethyl-3-oxo-3-piperazin-1-ylpropanoic acid |
|---|---|
| PubChem CID | 82820893 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-piperazin-1-ylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C9H16N2O3/c1-9(2,8(13)14)7(12)11-5-3-10-4-6-11/h10H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | GPANLTYYECORGB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|