C9H15NO5 — CID 106670964
3-(3,4-dihydroxypyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 106670964) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 106670964 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C9H15NO5/c1-9(2,8(14)15)7(13)10-3-5(11)6(12)4-10/h5-6,11-12H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | WDMCXXOJPOXLHP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|