C10H15F2NO3 — CID 155956827
3-(3,3-difluoro-4-methylpyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 155956827) has the molecular formula C10H15F2NO3 and a molecular weight of 235.23 g/mol. Its IUPAC name is 3-(3,3-difluoro-4-methylpyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(3,3-difluoro-4-methylpyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 155956827 |
| Molecular Formula | C10H15F2NO3 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(3,3-difluoro-4-methylpyrrolidin-1-yl)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC1CN(C(=O)C(C)(C)C(=O)O)CC1(F)F |
| InChI | InChI=1S/C10H15F2NO3/c1-6-4-13(5-10(6,11)12)7(14)9(2,3)8(15)16/h6H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | DRCJBJLSIFETRY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|