C9H15NO5S — CID 82820987
3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82820987) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82820987 |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H15NO5S/c1-9(2,8(12)13)7(11)10-3-5-16(14,15)6-4-10/h3-6H2,1-2H3,(H,12,13) |
| InChIKey | WHNIKZDHKGMTGR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|