C7H9F3N2O2S — CID 175551342
sulfanylidenemethanone;2,2,2-trifluoro-1-piperazin-1-ylethanone (PubChem CID 175551342) has the molecular formula C7H9F3N2O2S and a molecular weight of 242.22 g/mol. Its IUPAC name is sulfanylidenemethanone;2,2,2-trifluoro-1-piperazin-1-ylethanone.
| Compound Name | sulfanylidenemethanone;2,2,2-trifluoro-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 175551342 |
| Molecular Formula | C7H9F3N2O2S |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | sulfanylidenemethanone;2,2,2-trifluoro-1-piperazin-1-ylethanone |
| SMILES | O=C(N1CCNCC1)C(F)(F)F.O=C=S |
| InChI | InChI=1S/C6H9F3N2O.COS/c7-6(8,9)5(12)11-3-1-10-2-4-11;2-1-3/h10H,1-4H2; |
| InChIKey | BHAUOKOFXCCIFH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|