C11H15F3N4O — CID 166981914
2,2,2-trifluoro-N-methylidene-N'-[(Z)-1-oxo-1-piperazin-1-ylbut-2-en-2-yl]ethanimidamide (PubChem CID 166981914) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methylidene-N'-[(Z)-1-oxo-1-piperazin-1-ylbut-2-en-2-yl]ethanimidamide.
| Compound Name | 2,2,2-trifluoro-N-methylidene-N'-[(Z)-1-oxo-1-piperazin-1-ylbut-2-en-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 166981914 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2,2,2-trifluoro-N-methylidene-N'-[(Z)-1-oxo-1-piperazin-1-ylbut-2-en-2-yl]ethanimidamide |
| SMILES | C=N/C(=N\C(=C/C)C(=O)N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N4O/c1-3-8(17-10(15-2)11(12,13)14)9(19)18-6-4-16-5-7-18/h3,16H,2,4-7H2,1H3/b8-3-,17-10- |
| InChIKey | SQINTADIVLEHCO-FJFPTREFSA-N |
| XLogP | 0.98 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|