C7H9F5N2 — CID 137459978
1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperazine (PubChem CID 137459978) has the molecular formula C7H9F5N2 and a molecular weight of 216.15 g/mol. Its IUPAC name is 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperazine.
| Compound Name | 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperazine |
|---|---|
| PubChem CID | 137459978 |
| Molecular Formula | C7H9F5N2 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperazine |
| SMILES | F/C(=C(/F)C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C7H9F5N2/c8-5(7(10,11)12)6(9)14-3-1-13-2-4-14/h13H,1-4H2/b6-5- |
| InChIKey | QHXBJBBNTRRPTC-WAYWQWQTSA-N |
| XLogP | 1.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|