C7H11F4N3 — CID 155323169
(E)-1,3,3,3-tetrafluoro-1-piperazin-1-ylprop-1-en-2-amine (PubChem CID 155323169) has the molecular formula C7H11F4N3 and a molecular weight of 213.18 g/mol. Its IUPAC name is (E)-1,3,3,3-tetrafluoro-1-piperazin-1-ylprop-1-en-2-amine.
| Compound Name | (E)-1,3,3,3-tetrafluoro-1-piperazin-1-ylprop-1-en-2-amine |
|---|---|
| PubChem CID | 155323169 |
| Molecular Formula | C7H11F4N3 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (E)-1,3,3,3-tetrafluoro-1-piperazin-1-ylprop-1-en-2-amine |
| SMILES | N/C(=C(/F)N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C7H11F4N3/c8-6(5(12)7(9,10)11)14-3-1-13-2-4-14/h13H,1-4,12H2/b6-5- |
| InChIKey | VBWZHIIAZAGRMW-WAYWQWQTSA-N |
| XLogP | 0.55 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|