About piperazine-1-carboxamide;zinc
piperazine-1-carboxamide;zinc (PubChem CID 175213463) has the molecular formula C5H11N3OZn
and a molecular weight of 194.55 g/mol. Its IUPAC name is piperazine-1-carboxamide;zinc.
Molecular Properties
| Compound Name | piperazine-1-carboxamide;zinc |
| PubChem CID | 175213463 |
| Molecular Formula | C5H11N3OZn |
| Molecular Weight | 194.55 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | piperazine-1-carboxamide;zinc |
| SMILES | NC(=O)N1CCNCC1.[Zn] |
| InChI | InChI=1S/C5H11N3O.Zn/c6-5(9)8-3-1-7-2-4-8;/h7H,1-4H2,(H2,6,9); |
| InChIKey | LWVOEIZADZUPIO-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.55 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze piperazine-1-carboxamide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1-carboxamide;zinc?
The IUPAC name of piperazine-1-carboxamide;zinc (CID 175213463) is piperazine-1-carboxamide;zinc.
What is the SMILES notation for piperazine-1-carboxamide;zinc?
The canonical SMILES for piperazine-1-carboxamide;zinc is NC(=O)N1CCNCC1.[Zn].
What is the InChIKey of piperazine-1-carboxamide;zinc?
The InChIKey is LWVOEIZADZUPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.Zn/c6-5(9)8-3-1-7-2-4-8;/h7H,1-4H2,(H2,6,9);.
What are the key properties of piperazine-1-carboxamide;zinc?
piperazine-1-carboxamide;zinc has a molecular weight of 194.55 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1-carboxamide;zinc is sourced from PubChem (CID 175213463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).