About piperazine-1-carbothioic S-acid
piperazine-1-carbothioic S-acid (PubChem CID 22219896) has the molecular formula C5H10N2OS
and a molecular weight of 146.22 g/mol. Its IUPAC name is piperazine-1-carbothioic S-acid.
Molecular Properties
| Compound Name | piperazine-1-carbothioic S-acid |
| PubChem CID | 22219896 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | piperazine-1-carbothioic S-acid |
| SMILES | O=C(S)N1CCNCC1 |
| InChI | InChI=1S/C5H10N2OS/c8-5(9)7-3-1-6-2-4-7/h6H,1-4H2,(H,8,9) |
| InChIKey | DVAFBRQCRKGRDW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze piperazine-1-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1-carbothioic S-acid?
The IUPAC name of piperazine-1-carbothioic S-acid (CID 22219896) is piperazine-1-carbothioic S-acid.
What is the SMILES notation for piperazine-1-carbothioic S-acid?
The canonical SMILES for piperazine-1-carbothioic S-acid is O=C(S)N1CCNCC1.
What is the InChIKey of piperazine-1-carbothioic S-acid?
The InChIKey is DVAFBRQCRKGRDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2OS/c8-5(9)7-3-1-6-2-4-7/h6H,1-4H2,(H,8,9).
What are the key properties of piperazine-1-carbothioic S-acid?
piperazine-1-carbothioic S-acid has a molecular weight of 146.22 g/mol, XLogP of -0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1-carbothioic S-acid is sourced from PubChem (CID 22219896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).