C9H15N3O2 — CID 130547937
1-(azetidin-1-yl)-2-piperazin-1-ylethane-1,2-dione (PubChem CID 130547937) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-2-piperazin-1-ylethane-1,2-dione.
| Compound Name | 1-(azetidin-1-yl)-2-piperazin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 130547937 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-(azetidin-1-yl)-2-piperazin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCNCC1)N1CCC1 |
| InChI | InChI=1S/C9H15N3O2/c13-8(11-4-1-5-11)9(14)12-6-2-10-3-7-12/h10H,1-7H2 |
| InChIKey | GZJJXKZVDSPUMH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|