About aziridine;aziridine-1-carboxamide
aziridine;aziridine-1-carboxamide (PubChem CID 157196797) has the molecular formula C5H11N3O
and a molecular weight of 129.16 g/mol. Its IUPAC name is aziridine;aziridine-1-carboxamide.
Molecular Properties
| Compound Name | aziridine;aziridine-1-carboxamide |
| PubChem CID | 157196797 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | aziridine;aziridine-1-carboxamide |
| SMILES | C1CN1.NC(=O)N1CC1 |
| InChI | InChI=1S/C3H6N2O.C2H5N/c4-3(6)5-1-2-5;1-2-3-1/h1-2H2,(H2,4,6);3H,1-2H2 |
| InChIKey | AQIMCKMINCBYBE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 68.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridine;aziridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridine;aziridine-1-carboxamide?
The IUPAC name of aziridine;aziridine-1-carboxamide (CID 157196797) is aziridine;aziridine-1-carboxamide.
What is the SMILES notation for aziridine;aziridine-1-carboxamide?
The canonical SMILES for aziridine;aziridine-1-carboxamide is C1CN1.NC(=O)N1CC1.
What is the InChIKey of aziridine;aziridine-1-carboxamide?
The InChIKey is AQIMCKMINCBYBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O.C2H5N/c4-3(6)5-1-2-5;1-2-3-1/h1-2H2,(H2,4,6);3H,1-2H2.
What are the key properties of aziridine;aziridine-1-carboxamide?
aziridine;aziridine-1-carboxamide has a molecular weight of 129.16 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aziridine;aziridine-1-carboxamide is sourced from PubChem (CID 157196797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).