About methanethiol;pyrrolidine-1-carboxamide
methanethiol;pyrrolidine-1-carboxamide (PubChem CID 155736349) has the molecular formula C6H14N2OS
and a molecular weight of 162.26 g/mol. Its IUPAC name is methanethiol;pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | methanethiol;pyrrolidine-1-carboxamide |
| PubChem CID | 155736349 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | methanethiol;pyrrolidine-1-carboxamide |
| SMILES | CS.NC(=O)N1CCCC1 |
| InChI | InChI=1S/C5H10N2O.CH4S/c6-5(8)7-3-1-2-4-7;1-2/h1-4H2,(H2,6,8);2H,1H3 |
| InChIKey | SBHCFAMLWHSBQS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;pyrrolidine-1-carboxamide?
The IUPAC name of methanethiol;pyrrolidine-1-carboxamide (CID 155736349) is methanethiol;pyrrolidine-1-carboxamide.
What is the SMILES notation for methanethiol;pyrrolidine-1-carboxamide?
The canonical SMILES for methanethiol;pyrrolidine-1-carboxamide is CS.NC(=O)N1CCCC1.
What is the InChIKey of methanethiol;pyrrolidine-1-carboxamide?
The InChIKey is SBHCFAMLWHSBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.CH4S/c6-5(8)7-3-1-2-4-7;1-2/h1-4H2,(H2,6,8);2H,1H3.
What are the key properties of methanethiol;pyrrolidine-1-carboxamide?
methanethiol;pyrrolidine-1-carboxamide has a molecular weight of 162.26 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;pyrrolidine-1-carboxamide is sourced from PubChem (CID 155736349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).