About ethane;piperidine-1-carboxamide
ethane;piperidine-1-carboxamide (PubChem CID 176963561) has the molecular formula C10H24N2O
and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;piperidine-1-carboxamide.
Molecular Properties
| Compound Name | ethane;piperidine-1-carboxamide |
| PubChem CID | 176963561 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethane;piperidine-1-carboxamide |
| SMILES | CC.CC.NC(=O)N1CCCCC1 |
| InChI | InChI=1S/C6H12N2O.2C2H6/c7-6(9)8-4-2-1-3-5-8;2*1-2/h1-5H2,(H2,7,9);2*1-2H3 |
| InChIKey | AGLMHXKOVNVXBB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;piperidine-1-carboxamide?
The IUPAC name of ethane;piperidine-1-carboxamide (CID 176963561) is ethane;piperidine-1-carboxamide.
What is the SMILES notation for ethane;piperidine-1-carboxamide?
The canonical SMILES for ethane;piperidine-1-carboxamide is CC.CC.NC(=O)N1CCCCC1.
What is the InChIKey of ethane;piperidine-1-carboxamide?
The InChIKey is AGLMHXKOVNVXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.2C2H6/c7-6(9)8-4-2-1-3-5-8;2*1-2/h1-5H2,(H2,7,9);2*1-2H3.
What are the key properties of ethane;piperidine-1-carboxamide?
ethane;piperidine-1-carboxamide has a molecular weight of 188.31 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;piperidine-1-carboxamide is sourced from PubChem (CID 176963561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).