About pyrazine;pyrrolidine-1-carboxamide
pyrazine;pyrrolidine-1-carboxamide (PubChem CID 68904578) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is pyrazine;pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | pyrazine;pyrrolidine-1-carboxamide |
| PubChem CID | 68904578 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | pyrazine;pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCCC1.c1cnccn1 |
| InChI | InChI=1S/C5H10N2O.C4H4N2/c6-5(8)7-3-1-2-4-7;1-2-6-4-3-5-1/h1-4H2,(H2,6,8);1-4H |
| InChIKey | NQEPCCQYWZLNDP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazine;pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine;pyrrolidine-1-carboxamide?
The IUPAC name of pyrazine;pyrrolidine-1-carboxamide (CID 68904578) is pyrazine;pyrrolidine-1-carboxamide.
What is the SMILES notation for pyrazine;pyrrolidine-1-carboxamide?
The canonical SMILES for pyrazine;pyrrolidine-1-carboxamide is NC(=O)N1CCCC1.c1cnccn1.
What is the InChIKey of pyrazine;pyrrolidine-1-carboxamide?
The InChIKey is NQEPCCQYWZLNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C4H4N2/c6-5(8)7-3-1-2-4-7;1-2-6-4-3-5-1/h1-4H2,(H2,6,8);1-4H.
What are the key properties of pyrazine;pyrrolidine-1-carboxamide?
pyrazine;pyrrolidine-1-carboxamide has a molecular weight of 194.24 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine;pyrrolidine-1-carboxamide is sourced from PubChem (CID 68904578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).