C11H23N3O3 — CID 68551332
3-[ethyl(methyl)amino]propanoic acid;pyrrolidine-1-carboxamide (PubChem CID 68551332) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-[ethyl(methyl)amino]propanoic acid;pyrrolidine-1-carboxamide.
| Compound Name | 3-[ethyl(methyl)amino]propanoic acid;pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 68551332 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 3-[ethyl(methyl)amino]propanoic acid;pyrrolidine-1-carboxamide |
| SMILES | CCN(C)CCC(=O)O.NC(=O)N1CCCC1 |
| InChI | InChI=1S/C6H13NO2.C5H10N2O/c1-3-7(2)5-4-6(8)9;6-5(8)7-3-1-2-4-7/h3-5H2,1-2H3,(H,8,9);1-4H2,(H2,6,8) |
| InChIKey | YXPOTCMQFDJPJA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |