About 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride
8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride (PubChem CID 67562559) has the molecular formula C13H28ClN3O3
and a molecular weight of 309.84 g/mol. Its IUPAC name is 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride |
| PubChem CID | 67562559 |
| Molecular Formula | C13H28ClN3O3 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)N1CCCC1.NCCCCCCCC(=O)O |
| InChI | InChI=1S/C8H17NO2.C5H10N2O.ClH/c9-7-5-3-1-2-4-6-8(10)11;6-5(8)7-3-1-2-4-7;/h1-7,9H2,(H,10,11);1-4H2,(H2,6,8);1H |
| InChIKey | FNXDQBFTBLVACC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride?
The IUPAC name of 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride (CID 67562559) is 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride.
What is the SMILES notation for 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride?
The canonical SMILES for 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride is Cl.NC(=O)N1CCCC1.NCCCCCCCC(=O)O.
What is the InChIKey of 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride?
The InChIKey is FNXDQBFTBLVACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.C5H10N2O.ClH/c9-7-5-3-1-2-4-6-8(10)11;6-5(8)7-3-1-2-4-7;/h1-7,9H2,(H,10,11);1-4H2,(H2,6,8);1H.
What are the key properties of 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride?
8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride has a molecular weight of 309.84 g/mol, XLogP of 1.95, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminooctanoic acid;pyrrolidine-1-carboxamide;hydrochloride is sourced from PubChem (CID 67562559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).