C12H23N3 — CID 178167002
2,2-dimethyl-3-piperazin-1-ylbut-3-enenitrile;ethane (PubChem CID 178167002) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-piperazin-1-ylbut-3-enenitrile;ethane.
| Compound Name | 2,2-dimethyl-3-piperazin-1-ylbut-3-enenitrile;ethane |
|---|---|
| PubChem CID | 178167002 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2,2-dimethyl-3-piperazin-1-ylbut-3-enenitrile;ethane |
| SMILES | C=C(N1CCNCC1)C(C)(C)C#N.CC |
| InChI | InChI=1S/C10H17N3.C2H6/c1-9(10(2,3)8-11)13-6-4-12-5-7-13;1-2/h12H,1,4-7H2,2-3H3;1-2H3 |
| InChIKey | UMYRRGHTQIJLDG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |