C16H15F3N2O2 — CID 172954421
(2E,4E)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-methyl-5-(trifluoromethyl)hepta-2,4,6-trienamide (PubChem CID 172954421) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is (2E,4E)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-methyl-5-(trifluoromethyl)hepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-methyl-5-(trifluoromethyl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 172954421 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2E,4E)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-methyl-5-(trifluoromethyl)hepta-2,4,6-trienamide |
| SMILES | C=C/C(=C\C=C(/C)C(=O)N/N=C/c1ccccc1O)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2/c1-3-13(16(17,18)19)9-8-11(2)15(23)21-20-10-12-6-4-5-7-14(12)22/h3-10,22H,1H2,2H3,(H,21,23)/b11-8+,13-9+,20-10+ |
| InChIKey | UEXUQSAEYFLRQR-ZDWHJDECSA-N |
| XLogP | 3.46 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|