C18H23F3O — CID 142206515
but-2-yne;(3E)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]oxy-4-(trifluoromethyl)hexa-1,3,5-triene (PubChem CID 142206515) has the molecular formula C18H23F3O and a molecular weight of 312.38 g/mol. Its IUPAC name is but-2-yne;(3E)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]oxy-4-(trifluoromethyl)hexa-1,3,5-triene.
| Compound Name | but-2-yne;(3E)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]oxy-4-(trifluoromethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 142206515 |
| Molecular Formula | C18H23F3O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | but-2-yne;(3E)-2-[(2E)-5-methylhexa-2,4-dien-3-yl]oxy-4-(trifluoromethyl)hexa-1,3,5-triene |
| SMILES | C=C/C(=C\C(=C)O/C(C=C(C)C)=C/C)C(F)(F)F.CC#CC |
| InChI | InChI=1S/C14H17F3O.C4H6/c1-6-12(14(15,16)17)9-11(5)18-13(7-2)8-10(3)4;1-3-4-2/h6-9H,1,5H2,2-4H3;1-2H3/b12-9+,13-7+; |
| InChIKey | GFHDVQUCXMUNFI-VENFTLGASA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|