C9H11F3O — CID 143740716
(3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol (PubChem CID 143740716) has the molecular formula C9H11F3O and a molecular weight of 192.18 g/mol. Its IUPAC name is (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol.
| Compound Name | (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 143740716 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol |
| SMILES | C=C(C)/C(O)=C\C(=CC)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O/c1-4-7(9(10,11)12)5-8(13)6(2)3/h4-5,13H,2H2,1,3H3/b7-4?,8-5+ |
| InChIKey | WFCKILGPWXQAPD-SNRNYVCESA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|