About (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol
(3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol (PubChem CID 143740716) has the molecular formula C9H11F3O
and a molecular weight of 192.18 g/mol. Its IUPAC name is (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol.
Molecular Properties
| Compound Name | (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol |
| PubChem CID | 143740716 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol |
| SMILES | C=C(C)/C(O)=C\C(=CC)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O/c1-4-7(9(10,11)12)5-8(13)6(2)3/h4-5,13H,2H2,1,3H3/b7-4?,8-5+ |
| InChIKey | WFCKILGPWXQAPD-SNRNYVCESA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol?
The IUPAC name of (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol (CID 143740716) is (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol.
What is the SMILES notation for (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol?
The canonical SMILES for (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol is C=C(C)/C(O)=C\C(=CC)C(F)(F)F.
What is the InChIKey of (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol?
The InChIKey is WFCKILGPWXQAPD-SNRNYVCESA-N. The full InChI is InChI=1S/C9H11F3O/c1-4-7(9(10,11)12)5-8(13)6(2)3/h4-5,13H,2H2,1,3H3/b7-4?,8-5+.
What are the key properties of (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol?
(3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol has a molecular weight of 192.18 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-3-ol is sourced from PubChem (CID 143740716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).