C7H6F6O — CID 134221847
(2Z,4E)-1,1,1-trifluoro-4-(trifluoromethyl)hexa-2,4-dien-2-ol (PubChem CID 134221847) has the molecular formula C7H6F6O and a molecular weight of 220.11 g/mol. Its IUPAC name is (2Z,4E)-1,1,1-trifluoro-4-(trifluoromethyl)hexa-2,4-dien-2-ol.
| Compound Name | (2Z,4E)-1,1,1-trifluoro-4-(trifluoromethyl)hexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 134221847 |
| Molecular Formula | C7H6F6O |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (2Z,4E)-1,1,1-trifluoro-4-(trifluoromethyl)hexa-2,4-dien-2-ol |
| SMILES | C/C=C(\C=C(/O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O/c1-2-4(6(8,9)10)3-5(14)7(11,12)13/h2-3,14H,1H3/b4-2+,5-3- |
| InChIKey | SZBWKEVPMIKXJE-HZDAAVBUSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|