C10H10F6 — CID 143161230
(2E,4E,6E)-3,5-bis(trifluoromethyl)octa-2,4,6-triene (PubChem CID 143161230) has the molecular formula C10H10F6 and a molecular weight of 244.18 g/mol. Its IUPAC name is (2E,4E,6E)-3,5-bis(trifluoromethyl)octa-2,4,6-triene.
| Compound Name | (2E,4E,6E)-3,5-bis(trifluoromethyl)octa-2,4,6-triene |
|---|---|
| PubChem CID | 143161230 |
| Molecular Formula | C10H10F6 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2E,4E,6E)-3,5-bis(trifluoromethyl)octa-2,4,6-triene |
| SMILES | C/C=C/C(=C\C(=C/C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6/c1-3-5-8(10(14,15)16)6-7(4-2)9(11,12)13/h3-6H,1-2H3/b5-3+,7-4+,8-6+ |
| InChIKey | JGIOZEANAVQSPE-SFVMLHGBSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|