C12H15F3N2O — CID 90860011
N-[2-amino-3-ethenylidene-5-(trifluoromethyl)octa-4,6-dienyl]formamide (PubChem CID 90860011) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-[2-amino-3-ethenylidene-5-(trifluoromethyl)octa-4,6-dienyl]formamide.
| Compound Name | N-[2-amino-3-ethenylidene-5-(trifluoromethyl)octa-4,6-dienyl]formamide |
|---|---|
| PubChem CID | 90860011 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[2-amino-3-ethenylidene-5-(trifluoromethyl)octa-4,6-dienyl]formamide |
| SMILES | C=C=C(C=C(C=CC)C(F)(F)F)C(N)CNC=O |
| InChI | InChI=1S/C12H15F3N2O/c1-3-5-10(12(13,14)15)6-9(4-2)11(16)7-17-8-18/h3,5-6,8,11H,2,7,16H2,1H3,(H,17,18) |
| InChIKey | WLNSMGYHYWJWMP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|