C8H17N3 — CID 163979290
(1Z,3Z)-1-N-(2-aminopropyl)penta-1,3-diene-1,2-diamine (PubChem CID 163979290) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is (1Z,3Z)-1-N-(2-aminopropyl)penta-1,3-diene-1,2-diamine.
| Compound Name | (1Z,3Z)-1-N-(2-aminopropyl)penta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 163979290 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (1Z,3Z)-1-N-(2-aminopropyl)penta-1,3-diene-1,2-diamine |
| SMILES | C/C=C\C(N)=C\NCC(C)N |
| InChI | InChI=1S/C8H17N3/c1-3-4-8(10)6-11-5-7(2)9/h3-4,6-7,11H,5,9-10H2,1-2H3/b4-3-,8-6- |
| InChIKey | SWYLVBDZBRHQCF-XYMCEGRYSA-N |
| XLogP | 0.30 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|