C9H18N2 — CID 163600047
1-N-[(Z)-3-methylidenepent-1-enyl]propane-1,2-diamine (PubChem CID 163600047) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-N-[(Z)-3-methylidenepent-1-enyl]propane-1,2-diamine.
| Compound Name | 1-N-[(Z)-3-methylidenepent-1-enyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 163600047 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-N-[(Z)-3-methylidenepent-1-enyl]propane-1,2-diamine |
| SMILES | C=C(/C=C\NCC(C)N)CC |
| InChI | InChI=1S/C9H18N2/c1-4-8(2)5-6-11-7-9(3)10/h5-6,9,11H,2,4,7,10H2,1,3H3/b6-5- |
| InChIKey | GWUVZXUEHSQGIW-WAYWQWQTSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|