C11H19N — CID 166854206
(1Z)-N-(2-methylbutyl)-3-methylidenepenta-1,4-dien-1-amine (PubChem CID 166854206) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (1Z)-N-(2-methylbutyl)-3-methylidenepenta-1,4-dien-1-amine.
| Compound Name | (1Z)-N-(2-methylbutyl)-3-methylidenepenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 166854206 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (1Z)-N-(2-methylbutyl)-3-methylidenepenta-1,4-dien-1-amine |
| SMILES | C=CC(=C)/C=C\NCC(C)CC |
| InChI | InChI=1S/C11H19N/c1-5-10(3)7-8-12-9-11(4)6-2/h5,7-8,11-12H,1,3,6,9H2,2,4H3/b8-7- |
| InChIKey | SJCFTIVSLFTPRM-FPLPWBNLSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|