C9H15F — CID 164597534
(2Z,4Z)-6-fluoro-4,5-dimethylhepta-2,4-diene (PubChem CID 164597534) has the molecular formula C9H15F and a molecular weight of 142.22 g/mol. Its IUPAC name is (2Z,4Z)-6-fluoro-4,5-dimethylhepta-2,4-diene.
| Compound Name | (2Z,4Z)-6-fluoro-4,5-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 164597534 |
| Molecular Formula | C9H15F |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | (2Z,4Z)-6-fluoro-4,5-dimethylhepta-2,4-diene |
| SMILES | C/C=C\C(C)=C(\C)C(C)F |
| InChI | InChI=1S/C9H15F/c1-5-6-7(2)8(3)9(4)10/h5-6,9H,1-4H3/b6-5-,8-7- |
| InChIKey | KBAGWFPBAKFJLD-ISTTXYCBSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|