C15H24F2 — CID 130242747
(2Z,4E)-8,8-difluoro-4,6-dimethyl-5-(3-methylbut-1-en-2-yl)octa-2,4-diene (PubChem CID 130242747) has the molecular formula C15H24F2 and a molecular weight of 242.35 g/mol. Its IUPAC name is (2Z,4E)-8,8-difluoro-4,6-dimethyl-5-(3-methylbut-1-en-2-yl)octa-2,4-diene.
| Compound Name | (2Z,4E)-8,8-difluoro-4,6-dimethyl-5-(3-methylbut-1-en-2-yl)octa-2,4-diene |
|---|---|
| PubChem CID | 130242747 |
| Molecular Formula | C15H24F2 |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2Z,4E)-8,8-difluoro-4,6-dimethyl-5-(3-methylbut-1-en-2-yl)octa-2,4-diene |
| SMILES | C=C(/C(=C(C)/C=C\C)C(C)CC(F)F)C(C)C |
| InChI | InChI=1S/C15H24F2/c1-7-8-11(4)15(13(6)10(2)3)12(5)9-14(16)17/h7-8,10,12,14H,6,9H2,1-5H3/b8-7-,15-11+ |
| InChIKey | OLXYWEMMAPQLQK-DUSHSTMDSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|